C27H22ClN3O3 — CID 66994106
(E)-3-(2-chloro-5-nitrophenyl)-1-[1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-en-1-one (PubChem CID 66994106) has the molecular formula C27H22ClN3O3 and a molecular weight of 471.94 g/mol. Its IUPAC name is (E)-3-(2-chloro-5-nitrophenyl)-1-[1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2-chloro-5-nitrophenyl)-1-[1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 66994106 |
| Molecular Formula | C27H22ClN3O3 |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | (E)-3-(2-chloro-5-nitrophenyl)-1-[1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-en-1-one |
| SMILES | Cc1ccc(C2c3[nH]c4ccccc4c3CCN2C(=O)/C=C/c2cc([N+](=O)[O-])ccc2Cl)cc1 |
| InChI | InChI=1S/C27H22ClN3O3/c1-17-6-8-18(9-7-17)27-26-22(21-4-2-3-5-24(21)29-26)14-15-30(27)25(32)13-10-19-16-20(31(33)34)11-12-23(19)28/h2-13,16,27,29H,14-15H2,1H3/b13-10+ |
| InChIKey | CLEAIDFHBDQLMO-JLHYYAGUSA-N |
| XLogP | 6.23 |
| TPSA | 79.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|