About N-[[4-[dimethylamino-(4-fluorophenyl)methyl]cyclohexyl]methyl]-3,3-dimethylbutanamide
N-[[4-[dimethylamino-(4-fluorophenyl)methyl]cyclohexyl]methyl]-3,3-dimethylbutanamide (PubChem CID 66994456) has the molecular formula C22H35FN2O
and a molecular weight of 362.53 g/mol. Its IUPAC name is N-[[4-[dimethylamino-(4-fluorophenyl)methyl]cyclohexyl]methyl]-3,3-dimethylbutanamide.
Molecular Properties
| Compound Name | N-[[4-[dimethylamino-(4-fluorophenyl)methyl]cyclohexyl]methyl]-3,3-dimethylbutanamide |
| PubChem CID | 66994456 |
| Molecular Formula | C22H35FN2O |
| Molecular Weight | 362.53 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | N-[[4-[dimethylamino-(4-fluorophenyl)methyl]cyclohexyl]methyl]-3,3-dimethylbutanamide |
| SMILES | CN(C)C(c1ccc(F)cc1)C1CCC(CNC(=O)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C22H35FN2O/c1-22(2,3)14-20(26)24-15-16-6-8-17(9-7-16)21(25(4)5)18-10-12-19(23)13-11-18/h10-13,16-17,21H,6-9,14-15H2,1-5H3,(H,24,26) |
| InChIKey | MSEBZEDTPXTYMB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[[4-[dimethylamino-(4-fluorophenyl)methyl]cyclohexyl]methyl]-3,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-[dimethylamino-(4-fluorophenyl)methyl]cyclohexyl]methyl]-3,3-dimethylbutanamide?
The IUPAC name of N-[[4-[dimethylamino-(4-fluorophenyl)methyl]cyclohexyl]methyl]-3,3-dimethylbutanamide (CID 66994456) is N-[[4-[dimethylamino-(4-fluorophenyl)methyl]cyclohexyl]methyl]-3,3-dimethylbutanamide.
What is the SMILES notation for N-[[4-[dimethylamino-(4-fluorophenyl)methyl]cyclohexyl]methyl]-3,3-dimethylbutanamide?
The canonical SMILES for N-[[4-[dimethylamino-(4-fluorophenyl)methyl]cyclohexyl]methyl]-3,3-dimethylbutanamide is CN(C)C(c1ccc(F)cc1)C1CCC(CNC(=O)CC(C)(C)C)CC1.
What is the InChIKey of N-[[4-[dimethylamino-(4-fluorophenyl)methyl]cyclohexyl]methyl]-3,3-dimethylbutanamide?
The InChIKey is MSEBZEDTPXTYMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H35FN2O/c1-22(2,3)14-20(26)24-15-16-6-8-17(9-7-16)21(25(4)5)18-10-12-19(23)13-11-18/h10-13,16-17,21H,6-9,14-15H2,1-5H3,(H,24,26).
What are the key properties of N-[[4-[dimethylamino-(4-fluorophenyl)methyl]cyclohexyl]methyl]-3,3-dimethylbutanamide?
N-[[4-[dimethylamino-(4-fluorophenyl)methyl]cyclohexyl]methyl]-3,3-dimethylbutanamide has a molecular weight of 362.53 g/mol, XLogP of 4.79, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-[dimethylamino-(4-fluorophenyl)methyl]cyclohexyl]methyl]-3,3-dimethylbutanamide is sourced from PubChem (CID 66994456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).