About [6-(2,6-diethylphenyl)-4-methylsulfanyl-3-pyridinyl]methanol
[6-(2,6-diethylphenyl)-4-methylsulfanyl-3-pyridinyl]methanol (PubChem CID 66994585) has the molecular formula C17H21NOS
and a molecular weight of 287.43 g/mol. Its IUPAC name is [6-(2,6-diethylphenyl)-4-methylsulfanyl-3-pyridinyl]methanol.
Molecular Properties
| Compound Name | [6-(2,6-diethylphenyl)-4-methylsulfanyl-3-pyridinyl]methanol |
| PubChem CID | 66994585 |
| Molecular Formula | C17H21NOS |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | [6-(2,6-diethylphenyl)-4-methylsulfanyl-3-pyridinyl]methanol |
| SMILES | CCc1cccc(CC)c1-c1cc(SC)c(CO)cn1 |
| InChI | InChI=1S/C17H21NOS/c1-4-12-7-6-8-13(5-2)17(12)15-9-16(20-3)14(11-19)10-18-15/h6-10,19H,4-5,11H2,1-3H3 |
| InChIKey | ZNLOVTLEHQNOGC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [6-(2,6-diethylphenyl)-4-methylsulfanyl-3-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(2,6-diethylphenyl)-4-methylsulfanyl-3-pyridinyl]methanol?
The IUPAC name of [6-(2,6-diethylphenyl)-4-methylsulfanyl-3-pyridinyl]methanol (CID 66994585) is [6-(2,6-diethylphenyl)-4-methylsulfanyl-3-pyridinyl]methanol.
What is the SMILES notation for [6-(2,6-diethylphenyl)-4-methylsulfanyl-3-pyridinyl]methanol?
The canonical SMILES for [6-(2,6-diethylphenyl)-4-methylsulfanyl-3-pyridinyl]methanol is CCc1cccc(CC)c1-c1cc(SC)c(CO)cn1.
What is the InChIKey of [6-(2,6-diethylphenyl)-4-methylsulfanyl-3-pyridinyl]methanol?
The InChIKey is ZNLOVTLEHQNOGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NOS/c1-4-12-7-6-8-13(5-2)17(12)15-9-16(20-3)14(11-19)10-18-15/h6-10,19H,4-5,11H2,1-3H3.
What are the key properties of [6-(2,6-diethylphenyl)-4-methylsulfanyl-3-pyridinyl]methanol?
[6-(2,6-diethylphenyl)-4-methylsulfanyl-3-pyridinyl]methanol has a molecular weight of 287.43 g/mol, XLogP of 4.09, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(2,6-diethylphenyl)-4-methylsulfanyl-3-pyridinyl]methanol is sourced from PubChem (CID 66994585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).