C12H21BN2O3 — CID 66995079
(2R)-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propan-2-ol (PubChem CID 66995079) has the molecular formula C12H21BN2O3 and a molecular weight of 252.12 g/mol. Its IUPAC name is (2R)-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propan-2-ol.
| Compound Name | (2R)-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 66995079 |
| Molecular Formula | C12H21BN2O3 |
| Molecular Weight | 252.12 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | (2R)-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propan-2-ol |
| SMILES | C[C@@H](O)Cn1ccc(B2OC(C)(C)C(C)(C)O2)n1 |
| InChI | InChI=1S/C12H21BN2O3/c1-9(16)8-15-7-6-10(14-15)13-17-11(2,3)12(4,5)18-13/h6-7,9,16H,8H2,1-5H3/t9-/m1/s1 |
| InChIKey | GEKRQNIMHPQNQT-SECBINFHSA-N |
| XLogP | 0.56 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.12 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|