About N-benzyl-N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]pentan-3-amine
N-benzyl-N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]pentan-3-amine (PubChem CID 66995096) has the molecular formula C30H40N2
and a molecular weight of 428.66 g/mol. Its IUPAC name is N-benzyl-N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]pentan-3-amine.
Molecular Properties
| Compound Name | N-benzyl-N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]pentan-3-amine |
| PubChem CID | 66995096 |
| Molecular Formula | C30H40N2 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.32 |
| IUPAC Name | N-benzyl-N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]pentan-3-amine |
| SMILES | CCc1cccc(CC)c1-c1cc(C)c(CN(Cc2ccccc2)C(CC)CC)c(C)n1 |
| InChI | InChI=1S/C30H40N2/c1-7-25-17-14-18-26(8-2)30(25)29-19-22(5)28(23(6)31-29)21-32(27(9-3)10-4)20-24-15-12-11-13-16-24/h11-19,27H,7-10,20-21H2,1-6H3 |
| InChIKey | JAODOEFCAXFWIA-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-benzyl-N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]pentan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]pentan-3-amine?
The IUPAC name of N-benzyl-N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]pentan-3-amine (CID 66995096) is N-benzyl-N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]pentan-3-amine.
What is the SMILES notation for N-benzyl-N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]pentan-3-amine?
The canonical SMILES for N-benzyl-N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]pentan-3-amine is CCc1cccc(CC)c1-c1cc(C)c(CN(Cc2ccccc2)C(CC)CC)c(C)n1.
What is the InChIKey of N-benzyl-N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]pentan-3-amine?
The InChIKey is JAODOEFCAXFWIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H40N2/c1-7-25-17-14-18-26(8-2)30(25)29-19-22(5)28(23(6)31-29)21-32(27(9-3)10-4)20-24-15-12-11-13-16-24/h11-19,27H,7-10,20-21H2,1-6H3.
What are the key properties of N-benzyl-N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]pentan-3-amine?
N-benzyl-N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]pentan-3-amine has a molecular weight of 428.66 g/mol, XLogP of 7.68, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N-[[6-(2,6-diethylphenyl)-2,4-dimethyl-3-pyridinyl]methyl]pentan-3-amine is sourced from PubChem (CID 66995096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).