About 6-amino-(1,3-15N2)1H-pyrimidin-2-one
6-amino-(1,3-15N2)1H-pyrimidin-2-one (PubChem CID 66995323) has the molecular formula C4H5N3O
and a molecular weight of 113.09 g/mol. Its IUPAC name is 6-amino-(1,3-15N2)1H-pyrimidin-2-one.
Molecular Properties
| Compound Name | 6-amino-(1,3-15N2)1H-pyrimidin-2-one |
| PubChem CID | 66995323 |
| Molecular Formula | C4H5N3O |
| Molecular Weight | 113.09 g/mol |
| Exact Mass | 113.04 |
| IUPAC Name | 6-amino-(1,3-15N2)1H-pyrimidin-2-one |
| SMILES | Nc1cc[15n]c(=O)[15nH]1 |
| InChI | InChI=1S/C4H5N3O/c5-3-1-2-6-4(8)7-3/h1-2H,(H3,5,6,7,8)/i6+1,7+1 |
| InChIKey | OPTASPLRGRRNAP-AKZCFXPHSA-N |
| XLogP | -0.65 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.09 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-(1,3-15N2)1H-pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-(1,3-15N2)1H-pyrimidin-2-one?
The IUPAC name of 6-amino-(1,3-15N2)1H-pyrimidin-2-one (CID 66995323) is 6-amino-(1,3-15N2)1H-pyrimidin-2-one.
What is the SMILES notation for 6-amino-(1,3-15N2)1H-pyrimidin-2-one?
The canonical SMILES for 6-amino-(1,3-15N2)1H-pyrimidin-2-one is Nc1cc[15n]c(=O)[15nH]1.
What is the InChIKey of 6-amino-(1,3-15N2)1H-pyrimidin-2-one?
The InChIKey is OPTASPLRGRRNAP-AKZCFXPHSA-N. The full InChI is InChI=1S/C4H5N3O/c5-3-1-2-6-4(8)7-3/h1-2H,(H3,5,6,7,8)/i6+1,7+1.
What are the key properties of 6-amino-(1,3-15N2)1H-pyrimidin-2-one?
6-amino-(1,3-15N2)1H-pyrimidin-2-one has a molecular weight of 113.09 g/mol, XLogP of -0.65, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-(1,3-15N2)1H-pyrimidin-2-one is sourced from PubChem (CID 66995323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).