C24H34N4O3 — CID 66995328
(3S,6S,8Z,10aR)-6-[[(2S)-2-(dimethylamino)propanoyl]amino]-5-oxo-N-(2-phenylethyl)-2,3,6,7,10,10a-hexahydro-1H-pyrrolo[1,2-a]azocine-3-carboxamide (PubChem CID 66995328) has the molecular formula C24H34N4O3 and a molecular weight of 426.56 g/mol. Its IUPAC name is (3S,6S,8Z,10aR)-6-[[(2S)-2-(dimethylamino)propanoyl]amino]-5-oxo-N-(2-phenylethyl)-2,3,6,7,10,10a-hexahydro-1H-pyrrolo[1,2-a]azocine-3-carboxamide.
| Compound Name | (3S,6S,8Z,10aR)-6-[[(2S)-2-(dimethylamino)propanoyl]amino]-5-oxo-N-(2-phenylethyl)-2,3,6,7,10,10a-hexahydro-1H-pyrrolo[1,2-a]azocine-3-carboxamide |
|---|---|
| PubChem CID | 66995328 |
| Molecular Formula | C24H34N4O3 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | (3S,6S,8Z,10aR)-6-[[(2S)-2-(dimethylamino)propanoyl]amino]-5-oxo-N-(2-phenylethyl)-2,3,6,7,10,10a-hexahydro-1H-pyrrolo[1,2-a]azocine-3-carboxamide |
| SMILES | C[C@@H](C(=O)N[C@H]1C/C=C\C[C@H]2CC[C@@H](C(=O)NCCc3ccccc3)N2C1=O)N(C)C |
| InChI | InChI=1S/C24H34N4O3/c1-17(27(2)3)22(29)26-20-12-8-7-11-19-13-14-21(28(19)24(20)31)23(30)25-16-15-18-9-5-4-6-10-18/h4-10,17,19-21H,11-16H2,1-3H3,(H,25,30)(H,26,29)/b8-7-/t17-,19-,20-,21-/m0/s1 |
| InChIKey | GCBGRKALMRTLED-LHRLRWLCSA-N |
| XLogP | 1.49 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|