About (1-methylpiperidin-4-yl) acetate
(1-methylpiperidin-4-yl) acetate (PubChem CID 66995449) has the molecular formula C8H15NO2
and a molecular weight of 158.21 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl) acetate.
Molecular Properties
| Compound Name | (1-methylpiperidin-4-yl) acetate |
| PubChem CID | 66995449 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 158.21 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | (1-methylpiperidin-4-yl) acetate |
| SMILES | C[13C](=O)OC1CCN(C)CC1 |
| InChI | InChI=1S/C8H15NO2/c1-7(10)11-8-3-5-9(2)6-4-8/h8H,3-6H2,1-2H3/i7+1 |
| InChIKey | RWPYOAUYOSFJQV-CDYZYAPPSA-N |
| XLogP | 0.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.21 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-methylpiperidin-4-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-4-yl) acetate?
The IUPAC name of (1-methylpiperidin-4-yl) acetate (CID 66995449) is (1-methylpiperidin-4-yl) acetate.
What is the SMILES notation for (1-methylpiperidin-4-yl) acetate?
The canonical SMILES for (1-methylpiperidin-4-yl) acetate is C[13C](=O)OC1CCN(C)CC1.
What is the InChIKey of (1-methylpiperidin-4-yl) acetate?
The InChIKey is RWPYOAUYOSFJQV-CDYZYAPPSA-N. The full InChI is InChI=1S/C8H15NO2/c1-7(10)11-8-3-5-9(2)6-4-8/h8H,3-6H2,1-2H3/i7+1.
What are the key properties of (1-methylpiperidin-4-yl) acetate?
(1-methylpiperidin-4-yl) acetate has a molecular weight of 158.21 g/mol, XLogP of 0.64, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-4-yl) acetate is sourced from PubChem (CID 66995449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).