About (2,4,5-13C3)1,3-dioxolan-2-one
(2,4,5-13C3)1,3-dioxolan-2-one (PubChem CID 66995588) has the molecular formula C3H4O3
and a molecular weight of 91.04 g/mol. Its IUPAC name is (2,4,5-13C3)1,3-dioxolan-2-one.
Molecular Properties
| Compound Name | (2,4,5-13C3)1,3-dioxolan-2-one |
| PubChem CID | 66995588 |
| Molecular Formula | C3H4O3 |
| Molecular Weight | 91.04 g/mol |
| Exact Mass | 91.03 |
| IUPAC Name | (2,4,5-13C3)1,3-dioxolan-2-one |
| SMILES | O=[13C]1O[13CH2][13CH2]O1 |
| InChI | InChI=1S/C3H4O3/c4-3-5-1-2-6-3/h1-2H2/i1+1,2+1,3+1 |
| InChIKey | KMTRUDSVKNLOMY-VMIGTVKRSA-N |
| XLogP | 0.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 91.04 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2,4,5-13C3)1,3-dioxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4,5-13C3)1,3-dioxolan-2-one?
The IUPAC name of (2,4,5-13C3)1,3-dioxolan-2-one (CID 66995588) is (2,4,5-13C3)1,3-dioxolan-2-one.
What is the SMILES notation for (2,4,5-13C3)1,3-dioxolan-2-one?
The canonical SMILES for (2,4,5-13C3)1,3-dioxolan-2-one is O=[13C]1O[13CH2][13CH2]O1.
What is the InChIKey of (2,4,5-13C3)1,3-dioxolan-2-one?
The InChIKey is KMTRUDSVKNLOMY-VMIGTVKRSA-N. The full InChI is InChI=1S/C3H4O3/c4-3-5-1-2-6-3/h1-2H2/i1+1,2+1,3+1.
What are the key properties of (2,4,5-13C3)1,3-dioxolan-2-one?
(2,4,5-13C3)1,3-dioxolan-2-one has a molecular weight of 91.04 g/mol, XLogP of 0.15, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4,5-13C3)1,3-dioxolan-2-one is sourced from PubChem (CID 66995588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).