C28H40N8O3 — CID 66995676
3-[2-(4-aminophenyl)ethyl]-7-[2-(2-hydroxybutylamino)ethyl]-1-pentyl-8-(1H-pyrazol-5-ylmethyl)purine-2,6-dione (PubChem CID 66995676) has the molecular formula C28H40N8O3 and a molecular weight of 536.68 g/mol. Its IUPAC name is 3-[2-(4-aminophenyl)ethyl]-7-[2-(2-hydroxybutylamino)ethyl]-1-pentyl-8-(1H-pyrazol-5-ylmethyl)purine-2,6-dione.
| Compound Name | 3-[2-(4-aminophenyl)ethyl]-7-[2-(2-hydroxybutylamino)ethyl]-1-pentyl-8-(1H-pyrazol-5-ylmethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 66995676 |
| Molecular Formula | C28H40N8O3 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.32 |
| IUPAC Name | 3-[2-(4-aminophenyl)ethyl]-7-[2-(2-hydroxybutylamino)ethyl]-1-pentyl-8-(1H-pyrazol-5-ylmethyl)purine-2,6-dione |
| SMILES | CCCCCn1c(=O)c2c(nc(Cc3ccn[nH]3)n2CCNCC(O)CC)n(CCc2ccc(N)cc2)c1=O |
| InChI | InChI=1S/C28H40N8O3/c1-3-5-6-15-36-27(38)25-26(35(28(36)39)16-12-20-7-9-21(29)10-8-20)32-24(18-22-11-13-31-33-22)34(25)17-14-30-19-23(37)4-2/h7-11,13,23,30,37H,3-6,12,14-19,29H2,1-2H3,(H,31,33) |
| InChIKey | QUWJOGSZSBJIFK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 148.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|