About imidazolidine-2,4-dione;propanoic acid
imidazolidine-2,4-dione;propanoic acid (PubChem CID 66995748) has the molecular formula C6H10N2O4
and a molecular weight of 174.16 g/mol. Its IUPAC name is imidazolidine-2,4-dione;propanoic acid.
Molecular Properties
| Compound Name | imidazolidine-2,4-dione;propanoic acid |
| PubChem CID | 66995748 |
| Molecular Formula | C6H10N2O4 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | imidazolidine-2,4-dione;propanoic acid |
| SMILES | CCC(=O)O.O=C1CNC(=O)N1 |
| InChI | InChI=1S/C3H4N2O2.C3H6O2/c6-2-1-4-3(7)5-2;1-2-3(4)5/h1H2,(H2,4,5,6,7);2H2,1H3,(H,4,5) |
| InChIKey | YWMXDYJYLYUSAI-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze imidazolidine-2,4-dione;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazolidine-2,4-dione;propanoic acid?
The IUPAC name of imidazolidine-2,4-dione;propanoic acid (CID 66995748) is imidazolidine-2,4-dione;propanoic acid.
What is the SMILES notation for imidazolidine-2,4-dione;propanoic acid?
The canonical SMILES for imidazolidine-2,4-dione;propanoic acid is CCC(=O)O.O=C1CNC(=O)N1.
What is the InChIKey of imidazolidine-2,4-dione;propanoic acid?
The InChIKey is YWMXDYJYLYUSAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2O2.C3H6O2/c6-2-1-4-3(7)5-2;1-2-3(4)5/h1H2,(H2,4,5,6,7);2H2,1H3,(H,4,5).
What are the key properties of imidazolidine-2,4-dione;propanoic acid?
imidazolidine-2,4-dione;propanoic acid has a molecular weight of 174.16 g/mol, XLogP of -0.69, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for imidazolidine-2,4-dione;propanoic acid is sourced from PubChem (CID 66995748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).