C20H24N4O2 — CID 66995786
2-[4-[4-methoxy-2-[(4-methylcyclohexyl)amino]pyrimidin-5-yl]phenoxy]acetonitrile (PubChem CID 66995786) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 2-[4-[4-methoxy-2-[(4-methylcyclohexyl)amino]pyrimidin-5-yl]phenoxy]acetonitrile.
| Compound Name | 2-[4-[4-methoxy-2-[(4-methylcyclohexyl)amino]pyrimidin-5-yl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 66995786 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 2-[4-[4-methoxy-2-[(4-methylcyclohexyl)amino]pyrimidin-5-yl]phenoxy]acetonitrile |
| SMILES | COc1nc(NC2CCC(C)CC2)ncc1-c1ccc(OCC#N)cc1 |
| InChI | InChI=1S/C20H24N4O2/c1-14-3-7-16(8-4-14)23-20-22-13-18(19(24-20)25-2)15-5-9-17(10-6-15)26-12-11-21/h5-6,9-10,13-14,16H,3-4,7-8,12H2,1-2H3,(H,22,23,24) |
| InChIKey | JOBWGKFVIZFKSP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |