About oxane;1,4-xylene
oxane;1,4-xylene (PubChem CID 66995829) has the molecular formula C13H20O
and a molecular weight of 192.30 g/mol. Its IUPAC name is oxane;1,4-xylene.
Molecular Properties
| Compound Name | oxane;1,4-xylene |
| PubChem CID | 66995829 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | oxane;1,4-xylene |
| SMILES | C1CCOCC1.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C8H10.C5H10O/c1-7-3-5-8(2)6-4-7;1-2-4-6-5-3-1/h3-6H,1-2H3;1-5H2 |
| InChIKey | QNAGIWIYHGEEEH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze oxane;1,4-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxane;1,4-xylene?
The IUPAC name of oxane;1,4-xylene (CID 66995829) is oxane;1,4-xylene.
What is the SMILES notation for oxane;1,4-xylene?
The canonical SMILES for oxane;1,4-xylene is C1CCOCC1.Cc1ccc(C)cc1.
What is the InChIKey of oxane;1,4-xylene?
The InChIKey is QNAGIWIYHGEEEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.C5H10O/c1-7-3-5-8(2)6-4-7;1-2-4-6-5-3-1/h3-6H,1-2H3;1-5H2.
What are the key properties of oxane;1,4-xylene?
oxane;1,4-xylene has a molecular weight of 192.30 g/mol, XLogP of 3.49, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for oxane;1,4-xylene is sourced from PubChem (CID 66995829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).