C21H30F3N3O — CID 66996537
(2S)-N-[(3aR,4S,6aS)-2-[4-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-methyl-2-(methylamino)pentanamide (PubChem CID 66996537) has the molecular formula C21H30F3N3O and a molecular weight of 397.49 g/mol. Its IUPAC name is (2S)-N-[(3aR,4S,6aS)-2-[4-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-methyl-2-(methylamino)pentanamide.
| Compound Name | (2S)-N-[(3aR,4S,6aS)-2-[4-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-methyl-2-(methylamino)pentanamide |
|---|---|
| PubChem CID | 66996537 |
| Molecular Formula | C21H30F3N3O |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | (2S)-N-[(3aR,4S,6aS)-2-[4-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-methyl-2-(methylamino)pentanamide |
| SMILES | CN[C@@H](CC(C)C)C(=O)N[C@H]1CC[C@@H]2CN(c3ccc(C(F)(F)F)cc3)C[C@@H]21 |
| InChI | InChI=1S/C21H30F3N3O/c1-13(2)10-19(25-3)20(28)26-18-9-4-14-11-27(12-17(14)18)16-7-5-15(6-8-16)21(22,23)24/h5-8,13-14,17-19,25H,4,9-12H2,1-3H3,(H,26,28)/t14-,17+,18+,19+/m1/s1 |
| InChIKey | JYBFTQONFCVPEW-FCLVOEFKSA-N |
| XLogP | 3.67 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |