C11H13N3 — CID 66996708
4b,8a,9,9a-tetrahydro-4aH-pyrido[2,3-b]indol-2-amine (PubChem CID 66996708) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 4b,8a,9,9a-tetrahydro-4aH-pyrido[2,3-b]indol-2-amine.
| Compound Name | 4b,8a,9,9a-tetrahydro-4aH-pyrido[2,3-b]indol-2-amine |
|---|---|
| PubChem CID | 66996708 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 4b,8a,9,9a-tetrahydro-4aH-pyrido[2,3-b]indol-2-amine |
| SMILES | NC1=NC2NC3C=CC=CC3C2C=C1 |
| InChI | InChI=1S/C11H13N3/c12-10-6-5-8-7-3-1-2-4-9(7)13-11(8)14-10/h1-9,11,13H,(H2,12,14) |
| InChIKey | VKOBDJBXLPIKML-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |