C30H39N3O3 — CID 66996710
N-(1-amino-1,2-dioxoheptan-3-yl)-2-[2-[4-[[cyclohexyl(methyl)amino]methyl]phenyl]ethenyl]benzamide (PubChem CID 66996710) has the molecular formula C30H39N3O3 and a molecular weight of 489.66 g/mol. Its IUPAC name is N-(1-amino-1,2-dioxoheptan-3-yl)-2-[2-[4-[[cyclohexyl(methyl)amino]methyl]phenyl]ethenyl]benzamide.
| Compound Name | N-(1-amino-1,2-dioxoheptan-3-yl)-2-[2-[4-[[cyclohexyl(methyl)amino]methyl]phenyl]ethenyl]benzamide |
|---|---|
| PubChem CID | 66996710 |
| Molecular Formula | C30H39N3O3 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.30 |
| IUPAC Name | N-(1-amino-1,2-dioxoheptan-3-yl)-2-[2-[4-[[cyclohexyl(methyl)amino]methyl]phenyl]ethenyl]benzamide |
| SMILES | CCCCC(NC(=O)c1ccccc1C=Cc1ccc(CN(C)C2CCCCC2)cc1)C(=O)C(N)=O |
| InChI | InChI=1S/C30H39N3O3/c1-3-4-14-27(28(34)29(31)35)32-30(36)26-13-9-8-10-24(26)20-19-22-15-17-23(18-16-22)21-33(2)25-11-6-5-7-12-25/h8-10,13,15-20,25,27H,3-7,11-12,14,21H2,1-2H3,(H2,31,35)(H,32,36) |
| InChIKey | AHPSLYJYDFELGQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|