About 4-(3-ethylsulfanylphenyl)-2,6-difluoroaniline
4-(3-ethylsulfanylphenyl)-2,6-difluoroaniline (PubChem CID 66996832) has the molecular formula C14H13F2NS
and a molecular weight of 265.33 g/mol. Its IUPAC name is 4-(3-ethylsulfanylphenyl)-2,6-difluoroaniline.
Molecular Properties
| Compound Name | 4-(3-ethylsulfanylphenyl)-2,6-difluoroaniline |
| PubChem CID | 66996832 |
| Molecular Formula | C14H13F2NS |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 4-(3-ethylsulfanylphenyl)-2,6-difluoroaniline |
| SMILES | CCSc1cccc(-c2cc(F)c(N)c(F)c2)c1 |
| InChI | InChI=1S/C14H13F2NS/c1-2-18-11-5-3-4-9(6-11)10-7-12(15)14(17)13(16)8-10/h3-8H,2,17H2,1H3 |
| InChIKey | UGKSPXRJOXWPBW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-ethylsulfanylphenyl)-2,6-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-ethylsulfanylphenyl)-2,6-difluoroaniline?
The IUPAC name of 4-(3-ethylsulfanylphenyl)-2,6-difluoroaniline (CID 66996832) is 4-(3-ethylsulfanylphenyl)-2,6-difluoroaniline.
What is the SMILES notation for 4-(3-ethylsulfanylphenyl)-2,6-difluoroaniline?
The canonical SMILES for 4-(3-ethylsulfanylphenyl)-2,6-difluoroaniline is CCSc1cccc(-c2cc(F)c(N)c(F)c2)c1.
What is the InChIKey of 4-(3-ethylsulfanylphenyl)-2,6-difluoroaniline?
The InChIKey is UGKSPXRJOXWPBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F2NS/c1-2-18-11-5-3-4-9(6-11)10-7-12(15)14(17)13(16)8-10/h3-8H,2,17H2,1H3.
What are the key properties of 4-(3-ethylsulfanylphenyl)-2,6-difluoroaniline?
4-(3-ethylsulfanylphenyl)-2,6-difluoroaniline has a molecular weight of 265.33 g/mol, XLogP of 4.33, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-ethylsulfanylphenyl)-2,6-difluoroaniline is sourced from PubChem (CID 66996832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).