About 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)imidazole-1-carbaldehyde
2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)imidazole-1-carbaldehyde (PubChem CID 66996841) has the molecular formula C11H11N3OS
and a molecular weight of 233.30 g/mol. Its IUPAC name is 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)imidazole-1-carbaldehyde.
Molecular Properties
| Compound Name | 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)imidazole-1-carbaldehyde |
| PubChem CID | 66996841 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)imidazole-1-carbaldehyde |
| SMILES | O=Cn1ccnc1N1CCc2sccc2C1 |
| InChI | InChI=1S/C11H11N3OS/c15-8-14-5-3-12-11(14)13-4-1-10-9(7-13)2-6-16-10/h2-3,5-6,8H,1,4,7H2 |
| InChIKey | JPNNKAIQRVSQOX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)imidazole-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)imidazole-1-carbaldehyde?
The IUPAC name of 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)imidazole-1-carbaldehyde (CID 66996841) is 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)imidazole-1-carbaldehyde.
What is the SMILES notation for 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)imidazole-1-carbaldehyde?
The canonical SMILES for 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)imidazole-1-carbaldehyde is O=Cn1ccnc1N1CCc2sccc2C1.
What is the InChIKey of 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)imidazole-1-carbaldehyde?
The InChIKey is JPNNKAIQRVSQOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3OS/c15-8-14-5-3-12-11(14)13-4-1-10-9(7-13)2-6-16-10/h2-3,5-6,8H,1,4,7H2.
What are the key properties of 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)imidazole-1-carbaldehyde?
2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)imidazole-1-carbaldehyde has a molecular weight of 233.30 g/mol, XLogP of 1.55, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)imidazole-1-carbaldehyde is sourced from PubChem (CID 66996841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).