C14H17F3N2 — CID 66996860
(3aR,4S,6aS)-2-[4-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine (PubChem CID 66996860) has the molecular formula C14H17F3N2 and a molecular weight of 270.30 g/mol. Its IUPAC name is (3aR,4S,6aS)-2-[4-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine.
| Compound Name | (3aR,4S,6aS)-2-[4-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
|---|---|
| PubChem CID | 66996860 |
| Molecular Formula | C14H17F3N2 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | (3aR,4S,6aS)-2-[4-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
| SMILES | N[C@H]1CC[C@@H]2CN(c3ccc(C(F)(F)F)cc3)C[C@@H]21 |
| InChI | InChI=1S/C14H17F3N2/c15-14(16,17)10-2-4-11(5-3-10)19-7-9-1-6-13(18)12(9)8-19/h2-5,9,12-13H,1,6-8,18H2/t9-,12+,13+/m1/s1 |
| InChIKey | IVQFUVIWDPPSSP-ICCXJUOJSA-N |
| XLogP | 2.88 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |