C19H29F2N3OS — CID 66996865
(2S)-N-[(3aR,4S,6aS)-2-[5-(difluoromethyl)thiophen-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-methyl-2-(methylamino)pentanamide (PubChem CID 66996865) has the molecular formula C19H29F2N3OS and a molecular weight of 385.52 g/mol. Its IUPAC name is (2S)-N-[(3aR,4S,6aS)-2-[5-(difluoromethyl)thiophen-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-methyl-2-(methylamino)pentanamide.
| Compound Name | (2S)-N-[(3aR,4S,6aS)-2-[5-(difluoromethyl)thiophen-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-methyl-2-(methylamino)pentanamide |
|---|---|
| PubChem CID | 66996865 |
| Molecular Formula | C19H29F2N3OS |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | (2S)-N-[(3aR,4S,6aS)-2-[5-(difluoromethyl)thiophen-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-methyl-2-(methylamino)pentanamide |
| SMILES | CN[C@@H](CC(C)C)C(=O)N[C@H]1CC[C@@H]2CN(c3csc(C(F)F)c3)C[C@@H]21 |
| InChI | InChI=1S/C19H29F2N3OS/c1-11(2)6-16(22-3)19(25)23-15-5-4-12-8-24(9-14(12)15)13-7-17(18(20)21)26-10-13/h7,10-12,14-16,18,22H,4-6,8-9H2,1-3H3,(H,23,25)/t12-,14+,15+,16+/m1/s1 |
| InChIKey | BKQGFJBDVFODOR-OEAJRASXSA-N |
| XLogP | 3.65 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |