C22H24FN3O4 — CID 66996881
5-[(4-fluorophenyl)methyl]-8-methoxy-15-methyl-5,10,15-triazatricyclo[8.6.0.02,7]hexadeca-1,7-diene-6,9,16-trione (PubChem CID 66996881) has the molecular formula C22H24FN3O4 and a molecular weight of 413.45 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)methyl]-8-methoxy-15-methyl-5,10,15-triazatricyclo[8.6.0.02,7]hexadeca-1,7-diene-6,9,16-trione.
| Compound Name | 5-[(4-fluorophenyl)methyl]-8-methoxy-15-methyl-5,10,15-triazatricyclo[8.6.0.02,7]hexadeca-1,7-diene-6,9,16-trione |
|---|---|
| PubChem CID | 66996881 |
| Molecular Formula | C22H24FN3O4 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 5-[(4-fluorophenyl)methyl]-8-methoxy-15-methyl-5,10,15-triazatricyclo[8.6.0.02,7]hexadeca-1,7-diene-6,9,16-trione |
| SMILES | COc1c2c(c3n(c1=O)CCCCN(C)C3=O)CCN(Cc1ccc(F)cc1)C2=O |
| InChI | InChI=1S/C22H24FN3O4/c1-24-10-3-4-11-26-18(21(24)28)16-9-12-25(13-14-5-7-15(23)8-6-14)20(27)17(16)19(30-2)22(26)29/h5-8H,3-4,9-13H2,1-2H3 |
| InChIKey | YIEAGQPKVGJQLF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |