C22H22ClN5O3 — CID 66996904
tert-butyl N-[4-[3-[3-(3-chlorophenyl)-1,2,4-triazol-1-yl]prop-2-enoylamino]phenyl]carbamate (PubChem CID 66996904) has the molecular formula C22H22ClN5O3 and a molecular weight of 439.90 g/mol. Its IUPAC name is tert-butyl N-[4-[3-[3-(3-chlorophenyl)-1,2,4-triazol-1-yl]prop-2-enoylamino]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[3-[3-(3-chlorophenyl)-1,2,4-triazol-1-yl]prop-2-enoylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 66996904 |
| Molecular Formula | C22H22ClN5O3 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | tert-butyl N-[4-[3-[3-(3-chlorophenyl)-1,2,4-triazol-1-yl]prop-2-enoylamino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(NC(=O)C=Cn2cnc(-c3cccc(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C22H22ClN5O3/c1-22(2,3)31-21(30)26-18-9-7-17(8-10-18)25-19(29)11-12-28-14-24-20(27-28)15-5-4-6-16(23)13-15/h4-14H,1-3H3,(H,25,29)(H,26,30) |
| InChIKey | UTSKESAKVLVKNU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|