About azetidin-3-yl 3-[3-[3-methoxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate
azetidin-3-yl 3-[3-[3-methoxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate (PubChem CID 66996942) has the molecular formula C16H15F3N4O3
and a molecular weight of 368.32 g/mol. Its IUPAC name is azetidin-3-yl 3-[3-[3-methoxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate.
Molecular Properties
| Compound Name | azetidin-3-yl 3-[3-[3-methoxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate |
| PubChem CID | 66996942 |
| Molecular Formula | C16H15F3N4O3 |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | azetidin-3-yl 3-[3-[3-methoxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate |
| SMILES | COc1cc(-c2ncn(C=CC(=O)OC3CNC3)n2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H15F3N4O3/c1-25-12-5-10(4-11(6-12)16(17,18)19)15-21-9-23(22-15)3-2-14(24)26-13-7-20-8-13/h2-6,9,13,20H,7-8H2,1H3 |
| InChIKey | GOWWQHMCOOJLAY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze azetidin-3-yl 3-[3-[3-methoxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidin-3-yl 3-[3-[3-methoxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate?
The IUPAC name of azetidin-3-yl 3-[3-[3-methoxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate (CID 66996942) is azetidin-3-yl 3-[3-[3-methoxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate.
What is the SMILES notation for azetidin-3-yl 3-[3-[3-methoxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate?
The canonical SMILES for azetidin-3-yl 3-[3-[3-methoxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate is COc1cc(-c2ncn(C=CC(=O)OC3CNC3)n2)cc(C(F)(F)F)c1.
What is the InChIKey of azetidin-3-yl 3-[3-[3-methoxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate?
The InChIKey is GOWWQHMCOOJLAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F3N4O3/c1-25-12-5-10(4-11(6-12)16(17,18)19)15-21-9-23(22-15)3-2-14(24)26-13-7-20-8-13/h2-6,9,13,20H,7-8H2,1H3.
What are the key properties of azetidin-3-yl 3-[3-[3-methoxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate?
azetidin-3-yl 3-[3-[3-methoxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate has a molecular weight of 368.32 g/mol, XLogP of 1.96, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for azetidin-3-yl 3-[3-[3-methoxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate is sourced from PubChem (CID 66996942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).