C20H30ClN3O — CID 66996961
(2S)-2-[[(3aR,4S,6aS)-2-(4-chlorophenyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-methylamino]-4-methylpentanamide (PubChem CID 66996961) has the molecular formula C20H30ClN3O and a molecular weight of 363.93 g/mol. Its IUPAC name is (2S)-2-[[(3aR,4S,6aS)-2-(4-chlorophenyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-methylamino]-4-methylpentanamide.
| Compound Name | (2S)-2-[[(3aR,4S,6aS)-2-(4-chlorophenyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-methylamino]-4-methylpentanamide |
|---|---|
| PubChem CID | 66996961 |
| Molecular Formula | C20H30ClN3O |
| Molecular Weight | 363.93 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | (2S)-2-[[(3aR,4S,6aS)-2-(4-chlorophenyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-methylamino]-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](C(N)=O)N(C)[C@H]1CC[C@@H]2CN(c3ccc(Cl)cc3)C[C@@H]21 |
| InChI | InChI=1S/C20H30ClN3O/c1-13(2)10-19(20(22)25)23(3)18-9-4-14-11-24(12-17(14)18)16-7-5-15(21)6-8-16/h5-8,13-14,17-19H,4,9-12H2,1-3H3,(H2,22,25)/t14-,17+,18+,19+/m1/s1 |
| InChIKey | PLKOXYDZHDIEGT-FCLVOEFKSA-N |
| XLogP | 3.39 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.93 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |