About [(3R)-2-[(2,6-dimethyl-4-pyridinyl)methyl]oxolan-3-yl]carbamic acid;hydrochloride
[(3R)-2-[(2,6-dimethyl-4-pyridinyl)methyl]oxolan-3-yl]carbamic acid;hydrochloride (PubChem CID 66997264) has the molecular formula C13H19ClN2O3
and a molecular weight of 286.76 g/mol. Its IUPAC name is [(3R)-2-[(2,6-dimethyl-4-pyridinyl)methyl]oxolan-3-yl]carbamic acid;hydrochloride.
Molecular Properties
| Compound Name | [(3R)-2-[(2,6-dimethyl-4-pyridinyl)methyl]oxolan-3-yl]carbamic acid;hydrochloride |
| PubChem CID | 66997264 |
| Molecular Formula | C13H19ClN2O3 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | [(3R)-2-[(2,6-dimethyl-4-pyridinyl)methyl]oxolan-3-yl]carbamic acid;hydrochloride |
| SMILES | Cc1cc(CC2OCC[C@H]2NC(=O)O)cc(C)n1.Cl |
| InChI | InChI=1S/C13H18N2O3.ClH/c1-8-5-10(6-9(2)14-8)7-12-11(3-4-18-12)15-13(16)17;/h5-6,11-12,15H,3-4,7H2,1-2H3,(H,16,17);1H/t11-,12?;/m1./s1 |
| InChIKey | OOCFECZRBKYINX-BAVFUAOSSA-N |
| XLogP | 2.09 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3R)-2-[(2,6-dimethyl-4-pyridinyl)methyl]oxolan-3-yl]carbamic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-2-[(2,6-dimethyl-4-pyridinyl)methyl]oxolan-3-yl]carbamic acid;hydrochloride?
The IUPAC name of [(3R)-2-[(2,6-dimethyl-4-pyridinyl)methyl]oxolan-3-yl]carbamic acid;hydrochloride (CID 66997264) is [(3R)-2-[(2,6-dimethyl-4-pyridinyl)methyl]oxolan-3-yl]carbamic acid;hydrochloride.
What is the SMILES notation for [(3R)-2-[(2,6-dimethyl-4-pyridinyl)methyl]oxolan-3-yl]carbamic acid;hydrochloride?
The canonical SMILES for [(3R)-2-[(2,6-dimethyl-4-pyridinyl)methyl]oxolan-3-yl]carbamic acid;hydrochloride is Cc1cc(CC2OCC[C@H]2NC(=O)O)cc(C)n1.Cl.
What is the InChIKey of [(3R)-2-[(2,6-dimethyl-4-pyridinyl)methyl]oxolan-3-yl]carbamic acid;hydrochloride?
The InChIKey is OOCFECZRBKYINX-BAVFUAOSSA-N. The full InChI is InChI=1S/C13H18N2O3.ClH/c1-8-5-10(6-9(2)14-8)7-12-11(3-4-18-12)15-13(16)17;/h5-6,11-12,15H,3-4,7H2,1-2H3,(H,16,17);1H/t11-,12?;/m1./s1.
What are the key properties of [(3R)-2-[(2,6-dimethyl-4-pyridinyl)methyl]oxolan-3-yl]carbamic acid;hydrochloride?
[(3R)-2-[(2,6-dimethyl-4-pyridinyl)methyl]oxolan-3-yl]carbamic acid;hydrochloride has a molecular weight of 286.76 g/mol, XLogP of 2.09, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-2-[(2,6-dimethyl-4-pyridinyl)methyl]oxolan-3-yl]carbamic acid;hydrochloride is sourced from PubChem (CID 66997264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).