C21H16Cl2N2O2 — CID 66997309
6-acetyl-3-(2,4-dichlorophenyl)-1,9-dimethylpyrido[2,3-b]indol-2-one (PubChem CID 66997309) has the molecular formula C21H16Cl2N2O2 and a molecular weight of 399.28 g/mol. Its IUPAC name is 6-acetyl-3-(2,4-dichlorophenyl)-1,9-dimethylpyrido[2,3-b]indol-2-one.
| Compound Name | 6-acetyl-3-(2,4-dichlorophenyl)-1,9-dimethylpyrido[2,3-b]indol-2-one |
|---|---|
| PubChem CID | 66997309 |
| Molecular Formula | C21H16Cl2N2O2 |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 6-acetyl-3-(2,4-dichlorophenyl)-1,9-dimethylpyrido[2,3-b]indol-2-one |
| SMILES | CC(=O)c1ccc2c(c1)c1cc(-c3ccc(Cl)cc3Cl)c(=O)n(C)c1n2C |
| InChI | InChI=1S/C21H16Cl2N2O2/c1-11(26)12-4-7-19-15(8-12)16-10-17(14-6-5-13(22)9-18(14)23)21(27)25(3)20(16)24(19)2/h4-10H,1-3H3 |
| InChIKey | VQVUPOPKFDESAR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |