C20H30FN3O — CID 66997391
(2S)-N-[(3aR,4S,6aS)-2-(3-fluorophenyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-methyl-2-(methylamino)pentanamide (PubChem CID 66997391) has the molecular formula C20H30FN3O and a molecular weight of 347.48 g/mol. Its IUPAC name is (2S)-N-[(3aR,4S,6aS)-2-(3-fluorophenyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-methyl-2-(methylamino)pentanamide.
| Compound Name | (2S)-N-[(3aR,4S,6aS)-2-(3-fluorophenyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-methyl-2-(methylamino)pentanamide |
|---|---|
| PubChem CID | 66997391 |
| Molecular Formula | C20H30FN3O |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | (2S)-N-[(3aR,4S,6aS)-2-(3-fluorophenyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-methyl-2-(methylamino)pentanamide |
| SMILES | CN[C@@H](CC(C)C)C(=O)N[C@H]1CC[C@@H]2CN(c3cccc(F)c3)C[C@@H]21 |
| InChI | InChI=1S/C20H30FN3O/c1-13(2)9-19(22-3)20(25)23-18-8-7-14-11-24(12-17(14)18)16-6-4-5-15(21)10-16/h4-6,10,13-14,17-19,22H,7-9,11-12H2,1-3H3,(H,23,25)/t14-,17+,18+,19+/m1/s1 |
| InChIKey | MKCXCWCJYBJLIK-FCLVOEFKSA-N |
| XLogP | 2.79 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |