C19H28F3N5O — CID 66997413
(2S)-N-[(3aR,4S,6aS)-2-[6-(trifluoromethyl)pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-methyl-2-(methylamino)pentanamide (PubChem CID 66997413) has the molecular formula C19H28F3N5O and a molecular weight of 399.46 g/mol. Its IUPAC name is (2S)-N-[(3aR,4S,6aS)-2-[6-(trifluoromethyl)pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-methyl-2-(methylamino)pentanamide.
| Compound Name | (2S)-N-[(3aR,4S,6aS)-2-[6-(trifluoromethyl)pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-methyl-2-(methylamino)pentanamide |
|---|---|
| PubChem CID | 66997413 |
| Molecular Formula | C19H28F3N5O |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | (2S)-N-[(3aR,4S,6aS)-2-[6-(trifluoromethyl)pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-methyl-2-(methylamino)pentanamide |
| SMILES | CN[C@@H](CC(C)C)C(=O)N[C@H]1CC[C@@H]2CN(c3ccc(C(F)(F)F)nn3)C[C@@H]21 |
| InChI | InChI=1S/C19H28F3N5O/c1-11(2)8-15(23-3)18(28)24-14-5-4-12-9-27(10-13(12)14)17-7-6-16(25-26-17)19(20,21)22/h6-7,11-15,23H,4-5,8-10H2,1-3H3,(H,24,28)/t12-,13+,14+,15+/m1/s1 |
| InChIKey | FZAXUPXWRCBNEE-QPSCCSFWSA-N |
| XLogP | 2.46 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |