About tert-butyl 5-(4-amino-3,5-difluorophenyl)-3-methylindazole-1-carboxylate
tert-butyl 5-(4-amino-3,5-difluorophenyl)-3-methylindazole-1-carboxylate (PubChem CID 66997419) has the molecular formula C19H19F2N3O2
and a molecular weight of 359.38 g/mol. Its IUPAC name is tert-butyl 5-(4-amino-3,5-difluorophenyl)-3-methylindazole-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 5-(4-amino-3,5-difluorophenyl)-3-methylindazole-1-carboxylate |
| PubChem CID | 66997419 |
| Molecular Formula | C19H19F2N3O2 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | tert-butyl 5-(4-amino-3,5-difluorophenyl)-3-methylindazole-1-carboxylate |
| SMILES | Cc1nn(C(=O)OC(C)(C)C)c2ccc(-c3cc(F)c(N)c(F)c3)cc12 |
| InChI | InChI=1S/C19H19F2N3O2/c1-10-13-7-11(12-8-14(20)17(22)15(21)9-12)5-6-16(13)24(23-10)18(25)26-19(2,3)4/h5-9H,22H2,1-4H3 |
| InChIKey | OZZFLZJWBHDLNL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 5-(4-amino-3,5-difluorophenyl)-3-methylindazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 5-(4-amino-3,5-difluorophenyl)-3-methylindazole-1-carboxylate?
The IUPAC name of tert-butyl 5-(4-amino-3,5-difluorophenyl)-3-methylindazole-1-carboxylate (CID 66997419) is tert-butyl 5-(4-amino-3,5-difluorophenyl)-3-methylindazole-1-carboxylate.
What is the SMILES notation for tert-butyl 5-(4-amino-3,5-difluorophenyl)-3-methylindazole-1-carboxylate?
The canonical SMILES for tert-butyl 5-(4-amino-3,5-difluorophenyl)-3-methylindazole-1-carboxylate is Cc1nn(C(=O)OC(C)(C)C)c2ccc(-c3cc(F)c(N)c(F)c3)cc12.
What is the InChIKey of tert-butyl 5-(4-amino-3,5-difluorophenyl)-3-methylindazole-1-carboxylate?
The InChIKey is OZZFLZJWBHDLNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19F2N3O2/c1-10-13-7-11(12-8-14(20)17(22)15(21)9-12)5-6-16(13)24(23-10)18(25)26-19(2,3)4/h5-9H,22H2,1-4H3.
What are the key properties of tert-butyl 5-(4-amino-3,5-difluorophenyl)-3-methylindazole-1-carboxylate?
tert-butyl 5-(4-amino-3,5-difluorophenyl)-3-methylindazole-1-carboxylate has a molecular weight of 359.38 g/mol, XLogP of 4.66, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 5-(4-amino-3,5-difluorophenyl)-3-methylindazole-1-carboxylate is sourced from PubChem (CID 66997419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).