C21H30N4O — CID 66997590
(2S)-N-[(3aR,4S,6aS)-2-(3-cyanophenyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-methyl-2-(methylamino)pentanamide (PubChem CID 66997590) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is (2S)-N-[(3aR,4S,6aS)-2-(3-cyanophenyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-methyl-2-(methylamino)pentanamide.
| Compound Name | (2S)-N-[(3aR,4S,6aS)-2-(3-cyanophenyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-methyl-2-(methylamino)pentanamide |
|---|---|
| PubChem CID | 66997590 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | (2S)-N-[(3aR,4S,6aS)-2-(3-cyanophenyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-methyl-2-(methylamino)pentanamide |
| SMILES | CN[C@@H](CC(C)C)C(=O)N[C@H]1CC[C@@H]2CN(c3cccc(C#N)c3)C[C@@H]21 |
| InChI | InChI=1S/C21H30N4O/c1-14(2)9-20(23-3)21(26)24-19-8-7-16-12-25(13-18(16)19)17-6-4-5-15(10-17)11-22/h4-6,10,14,16,18-20,23H,7-9,12-13H2,1-3H3,(H,24,26)/t16-,18+,19+,20+/m1/s1 |
| InChIKey | YOUXBIYVBXGQLW-GTAWCEEGSA-N |
| XLogP | 2.52 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |