C21H26F2N4O3 — CID 66997712
3-(3,4-difluorophenyl)-N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-5-hydroxy-4,5,6,7-tetrahydroindazole-1-carboxamide (PubChem CID 66997712) has the molecular formula C21H26F2N4O3 and a molecular weight of 420.46 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-5-hydroxy-4,5,6,7-tetrahydroindazole-1-carboxamide.
| Compound Name | 3-(3,4-difluorophenyl)-N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-5-hydroxy-4,5,6,7-tetrahydroindazole-1-carboxamide |
|---|---|
| PubChem CID | 66997712 |
| Molecular Formula | C21H26F2N4O3 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 3-(3,4-difluorophenyl)-N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-5-hydroxy-4,5,6,7-tetrahydroindazole-1-carboxamide |
| SMILES | CNC(=O)C(NC(=O)n1nc(-c2ccc(F)c(F)c2)c2c1CCC(O)C2)C(C)(C)C |
| InChI | InChI=1S/C21H26F2N4O3/c1-21(2,3)18(19(29)24-4)25-20(30)27-16-8-6-12(28)10-13(16)17(26-27)11-5-7-14(22)15(23)9-11/h5,7,9,12,18,28H,6,8,10H2,1-4H3,(H,24,29)(H,25,30) |
| InChIKey | CZCYAMFEZYCAEH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |