C12H15N3 — CID 66997864
5,6-dimethyl-1,8,9,10-tetrahydroimidazo[2,1-a][2,6]naphthyridine (PubChem CID 66997864) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 5,6-dimethyl-1,8,9,10-tetrahydroimidazo[2,1-a][2,6]naphthyridine.
| Compound Name | 5,6-dimethyl-1,8,9,10-tetrahydroimidazo[2,1-a][2,6]naphthyridine |
|---|---|
| PubChem CID | 66997864 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 5,6-dimethyl-1,8,9,10-tetrahydroimidazo[2,1-a][2,6]naphthyridine |
| SMILES | CC1=C(C)N2C=CNC2=C2CCNC=C12 |
| InChI | InChI=1S/C12H15N3/c1-8-9(2)15-6-5-14-12(15)10-3-4-13-7-11(8)10/h5-7,13-14H,3-4H2,1-2H3 |
| InChIKey | MGEVYYMDESRVFS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |