About N'-(4-iodophenyl)-N,N'-dimethylacetohydrazide
N'-(4-iodophenyl)-N,N'-dimethylacetohydrazide (PubChem CID 66998219) has the molecular formula C10H13IN2O
and a molecular weight of 304.13 g/mol. Its IUPAC name is N'-(4-iodophenyl)-N,N'-dimethylacetohydrazide.
Molecular Properties
| Compound Name | N'-(4-iodophenyl)-N,N'-dimethylacetohydrazide |
| PubChem CID | 66998219 |
| Molecular Formula | C10H13IN2O |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | N'-(4-iodophenyl)-N,N'-dimethylacetohydrazide |
| SMILES | CC(=O)N(C)N(C)c1ccc(I)cc1 |
| InChI | InChI=1S/C10H13IN2O/c1-8(14)12(2)13(3)10-6-4-9(11)5-7-10/h4-7H,1-3H3 |
| InChIKey | VCGGDZHUQOWPEQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(4-iodophenyl)-N,N'-dimethylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-iodophenyl)-N,N'-dimethylacetohydrazide?
The IUPAC name of N'-(4-iodophenyl)-N,N'-dimethylacetohydrazide (CID 66998219) is N'-(4-iodophenyl)-N,N'-dimethylacetohydrazide.
What is the SMILES notation for N'-(4-iodophenyl)-N,N'-dimethylacetohydrazide?
The canonical SMILES for N'-(4-iodophenyl)-N,N'-dimethylacetohydrazide is CC(=O)N(C)N(C)c1ccc(I)cc1.
What is the InChIKey of N'-(4-iodophenyl)-N,N'-dimethylacetohydrazide?
The InChIKey is VCGGDZHUQOWPEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13IN2O/c1-8(14)12(2)13(3)10-6-4-9(11)5-7-10/h4-7H,1-3H3.
What are the key properties of N'-(4-iodophenyl)-N,N'-dimethylacetohydrazide?
N'-(4-iodophenyl)-N,N'-dimethylacetohydrazide has a molecular weight of 304.13 g/mol, XLogP of 2.12, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-iodophenyl)-N,N'-dimethylacetohydrazide is sourced from PubChem (CID 66998219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).