C25H23Cl2N3O3 — CID 66998305
1-[3-(2,4-dichlorophenyl)-1,9-dimethyl-2-oxopyrido[2,3-b]indol-6-yl]-4-(dimethylamino)butane-1,3-dione (PubChem CID 66998305) has the molecular formula C25H23Cl2N3O3 and a molecular weight of 484.38 g/mol. Its IUPAC name is 1-[3-(2,4-dichlorophenyl)-1,9-dimethyl-2-oxopyrido[2,3-b]indol-6-yl]-4-(dimethylamino)butane-1,3-dione.
| Compound Name | 1-[3-(2,4-dichlorophenyl)-1,9-dimethyl-2-oxopyrido[2,3-b]indol-6-yl]-4-(dimethylamino)butane-1,3-dione |
|---|---|
| PubChem CID | 66998305 |
| Molecular Formula | C25H23Cl2N3O3 |
| Molecular Weight | 484.38 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 1-[3-(2,4-dichlorophenyl)-1,9-dimethyl-2-oxopyrido[2,3-b]indol-6-yl]-4-(dimethylamino)butane-1,3-dione |
| SMILES | CN(C)CC(=O)CC(=O)c1ccc2c(c1)c1cc(-c3ccc(Cl)cc3Cl)c(=O)n(C)c1n2C |
| InChI | InChI=1S/C25H23Cl2N3O3/c1-28(2)13-16(31)11-23(32)14-5-8-22-18(9-14)19-12-20(17-7-6-15(26)10-21(17)27)25(33)30(4)24(19)29(22)3/h5-10,12H,11,13H2,1-4H3 |
| InChIKey | CUWUXNMJRAEVNU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 64.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.38 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|