C28H30Cl2N4O2Si — CID 66998432
3-(2,4-dichlorophenyl)-1-methyl-6-(1-methylpyrazol-3-yl)-9-(2-trimethylsilylethoxymethyl)pyrido[2,3-b]indol-2-one (PubChem CID 66998432) has the molecular formula C28H30Cl2N4O2Si and a molecular weight of 553.57 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1-methyl-6-(1-methylpyrazol-3-yl)-9-(2-trimethylsilylethoxymethyl)pyrido[2,3-b]indol-2-one.
| Compound Name | 3-(2,4-dichlorophenyl)-1-methyl-6-(1-methylpyrazol-3-yl)-9-(2-trimethylsilylethoxymethyl)pyrido[2,3-b]indol-2-one |
|---|---|
| PubChem CID | 66998432 |
| Molecular Formula | C28H30Cl2N4O2Si |
| Molecular Weight | 553.57 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1-methyl-6-(1-methylpyrazol-3-yl)-9-(2-trimethylsilylethoxymethyl)pyrido[2,3-b]indol-2-one |
| SMILES | Cn1ccc(-c2ccc3c(c2)c2cc(-c4ccc(Cl)cc4Cl)c(=O)n(C)c2n3COCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C28H30Cl2N4O2Si/c1-32-11-10-25(31-32)18-6-9-26-21(14-18)22-16-23(20-8-7-19(29)15-24(20)30)28(35)33(2)27(22)34(26)17-36-12-13-37(3,4)5/h6-11,14-16H,12-13,17H2,1-5H3 |
| InChIKey | DFRDHCOOWQZVGE-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.57 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|