About ethyl 2-(4,5-difluoro-2,3-dihydro-1H-inden-1-yl)acetate
ethyl 2-(4,5-difluoro-2,3-dihydro-1H-inden-1-yl)acetate (PubChem CID 66998529) has the molecular formula C13H14F2O2
and a molecular weight of 240.25 g/mol. Its IUPAC name is ethyl 2-(4,5-difluoro-2,3-dihydro-1H-inden-1-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(4,5-difluoro-2,3-dihydro-1H-inden-1-yl)acetate |
| PubChem CID | 66998529 |
| Molecular Formula | C13H14F2O2 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | ethyl 2-(4,5-difluoro-2,3-dihydro-1H-inden-1-yl)acetate |
| SMILES | CCOC(=O)CC1CCc2c1ccc(F)c2F |
| InChI | InChI=1S/C13H14F2O2/c1-2-17-12(16)7-8-3-4-10-9(8)5-6-11(14)13(10)15/h5-6,8H,2-4,7H2,1H3 |
| InChIKey | ZEWVCTHJAJZNDZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl 2-(4,5-difluoro-2,3-dihydro-1H-inden-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4,5-difluoro-2,3-dihydro-1H-inden-1-yl)acetate?
The IUPAC name of ethyl 2-(4,5-difluoro-2,3-dihydro-1H-inden-1-yl)acetate (CID 66998529) is ethyl 2-(4,5-difluoro-2,3-dihydro-1H-inden-1-yl)acetate.
What is the SMILES notation for ethyl 2-(4,5-difluoro-2,3-dihydro-1H-inden-1-yl)acetate?
The canonical SMILES for ethyl 2-(4,5-difluoro-2,3-dihydro-1H-inden-1-yl)acetate is CCOC(=O)CC1CCc2c1ccc(F)c2F.
What is the InChIKey of ethyl 2-(4,5-difluoro-2,3-dihydro-1H-inden-1-yl)acetate?
The InChIKey is ZEWVCTHJAJZNDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F2O2/c1-2-17-12(16)7-8-3-4-10-9(8)5-6-11(14)13(10)15/h5-6,8H,2-4,7H2,1H3.
What are the key properties of ethyl 2-(4,5-difluoro-2,3-dihydro-1H-inden-1-yl)acetate?
ethyl 2-(4,5-difluoro-2,3-dihydro-1H-inden-1-yl)acetate has a molecular weight of 240.25 g/mol, XLogP of 2.95, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4,5-difluoro-2,3-dihydro-1H-inden-1-yl)acetate is sourced from PubChem (CID 66998529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).