C24H22FN5O2S2 — CID 66998605
N-[[(1S,2S,5R)-3-[4-(4-fluorophenyl)-2-methyl-1,3-thiazole-5-carbonyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]-6-methylimidazo[2,1-b][1,3]thiazole-5-carboxamide (PubChem CID 66998605) has the molecular formula C24H22FN5O2S2 and a molecular weight of 495.61 g/mol. Its IUPAC name is N-[[(1S,2S,5R)-3-[4-(4-fluorophenyl)-2-methyl-1,3-thiazole-5-carbonyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]-6-methylimidazo[2,1-b][1,3]thiazole-5-carboxamide.
| Compound Name | N-[[(1S,2S,5R)-3-[4-(4-fluorophenyl)-2-methyl-1,3-thiazole-5-carbonyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]-6-methylimidazo[2,1-b][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 66998605 |
| Molecular Formula | C24H22FN5O2S2 |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | N-[[(1S,2S,5R)-3-[4-(4-fluorophenyl)-2-methyl-1,3-thiazole-5-carbonyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]-6-methylimidazo[2,1-b][1,3]thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2ccc(F)cc2)c(C(=O)N2C[C@@H]3C[C@@H]3[C@H]2CNC(=O)c2c(C)nc3sccn23)s1 |
| InChI | InChI=1S/C24H22FN5O2S2/c1-12-20(29-7-8-33-24(29)27-12)22(31)26-10-18-17-9-15(17)11-30(18)23(32)21-19(28-13(2)34-21)14-3-5-16(25)6-4-14/h3-8,15,17-18H,9-11H2,1-2H3,(H,26,31)/t15-,17-,18+/m0/s1 |
| InChIKey | NNUKMFYSEMPZDV-RYQLBKOJSA-N |
| XLogP | 4.17 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |