C26H26N6O2S — CID 66998706
3-ethyl-N-[[(1S,2S,5R)-3-(2-methyl-4-phenylpyrimidine-5-carbonyl)-3-azabicyclo[3.1.0]hexan-2-yl]methyl]imidazo[2,1-b][1,3]thiazole-5-carboxamide (PubChem CID 66998706) has the molecular formula C26H26N6O2S and a molecular weight of 486.60 g/mol. Its IUPAC name is 3-ethyl-N-[[(1S,2S,5R)-3-(2-methyl-4-phenylpyrimidine-5-carbonyl)-3-azabicyclo[3.1.0]hexan-2-yl]methyl]imidazo[2,1-b][1,3]thiazole-5-carboxamide.
| Compound Name | 3-ethyl-N-[[(1S,2S,5R)-3-(2-methyl-4-phenylpyrimidine-5-carbonyl)-3-azabicyclo[3.1.0]hexan-2-yl]methyl]imidazo[2,1-b][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 66998706 |
| Molecular Formula | C26H26N6O2S |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 3-ethyl-N-[[(1S,2S,5R)-3-(2-methyl-4-phenylpyrimidine-5-carbonyl)-3-azabicyclo[3.1.0]hexan-2-yl]methyl]imidazo[2,1-b][1,3]thiazole-5-carboxamide |
| SMILES | CCc1csc2ncc(C(=O)NC[C@@H]3[C@H]4C[C@H]4CN3C(=O)c3cnc(C)nc3-c3ccccc3)n12 |
| InChI | InChI=1S/C26H26N6O2S/c1-3-18-14-35-26-29-12-22(32(18)26)24(33)28-11-21-19-9-17(19)13-31(21)25(34)20-10-27-15(2)30-23(20)16-7-5-4-6-8-16/h4-8,10,12,14,17,19,21H,3,9,11,13H2,1-2H3,(H,28,33)/t17-,19-,21+/m0/s1 |
| InChIKey | NVKAURBKHXUHDI-HFSMHLIXSA-N |
| XLogP | 3.61 |
| TPSA | 92.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |