methyl 5-fluoro-2,3-dihydro-1H-indene-2-carboxylate

C11H11FO2 — CID 66998845

IUPACmethyl 5-fluoro-2,3-dihydro-1H-indene-2-carboxylate
SMILESCOC(=O)C1Cc2ccc(F)cc2C1
InChIInChI=1S/C11H11FO2/c1-14-11(13)9-4-7-2-3-10(12)6-8(7)5-9/h2-3,6,9H,4-5H2,1H3
InChIKeyMIZJGPQVOBOFOU-UHFFFAOYSA-N
MW194.21 g/mol
LogP1.71
Rot. Bonds1

About methyl 5-fluoro-2,3-dihydro-1H-indene-2-carboxylate

methyl 5-fluoro-2,3-dihydro-1H-indene-2-carboxylate (PubChem CID 66998845) has the molecular formula C11H11FO2 and a molecular weight of 194.21 g/mol. Its IUPAC name is methyl 5-fluoro-2,3-dihydro-1H-indene-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-fluoro-2,3-dihydro-1H-indene-2-carboxylate
PubChem CID66998845
Molecular FormulaC11H11FO2
Molecular Weight194.21 g/mol
Exact Mass194.07
IUPAC Namemethyl 5-fluoro-2,3-dihydro-1H-indene-2-carboxylate
SMILESCOC(=O)C1Cc2ccc(F)cc2C1
InChIInChI=1S/C11H11FO2/c1-14-11(13)9-4-7-2-3-10(12)6-8(7)5-9/h2-3,6,9H,4-5H2,1H3
InChIKeyMIZJGPQVOBOFOU-UHFFFAOYSA-N
XLogP1.71
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.21
LogP ≤ 51.71
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 5-fluoro-2,3-dihydro-1H-indene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-fluoro-2,3-dihydro-1H-indene-2-carboxylate?
The IUPAC name of methyl 5-fluoro-2,3-dihydro-1H-indene-2-carboxylate (CID 66998845) is methyl 5-fluoro-2,3-dihydro-1H-indene-2-carboxylate.
What is the SMILES notation for methyl 5-fluoro-2,3-dihydro-1H-indene-2-carboxylate?
The canonical SMILES for methyl 5-fluoro-2,3-dihydro-1H-indene-2-carboxylate is COC(=O)C1Cc2ccc(F)cc2C1.
What is the InChIKey of methyl 5-fluoro-2,3-dihydro-1H-indene-2-carboxylate?
The InChIKey is MIZJGPQVOBOFOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FO2/c1-14-11(13)9-4-7-2-3-10(12)6-8(7)5-9/h2-3,6,9H,4-5H2,1H3.
What are the key properties of methyl 5-fluoro-2,3-dihydro-1H-indene-2-carboxylate?
methyl 5-fluoro-2,3-dihydro-1H-indene-2-carboxylate has a molecular weight of 194.21 g/mol, XLogP of 1.71, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-fluoro-2,3-dihydro-1H-indene-2-carboxylate is sourced from PubChem (CID 66998845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).