About 2-[1-[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]ethoxy]-5-(trifluoromethyl)pyridine
2-[1-[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]ethoxy]-5-(trifluoromethyl)pyridine (PubChem CID 66999110) has the molecular formula C18H17Cl2F3N2O
and a molecular weight of 405.25 g/mol. Its IUPAC name is 2-[1-[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]ethoxy]-5-(trifluoromethyl)pyridine.
Molecular Properties
| Compound Name | 2-[1-[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]ethoxy]-5-(trifluoromethyl)pyridine |
| PubChem CID | 66999110 |
| Molecular Formula | C18H17Cl2F3N2O |
| Molecular Weight | 405.25 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 2-[1-[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]ethoxy]-5-(trifluoromethyl)pyridine |
| SMILES | CC(Oc1ccc(C(F)(F)F)cn1)C1CNCC1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H17Cl2F3N2O/c1-10(26-17-5-3-12(7-25-17)18(21,22)23)13-8-24-9-14(13)11-2-4-15(19)16(20)6-11/h2-7,10,13-14,24H,8-9H2,1H3 |
| InChIKey | ZGOMNLGNLAFFBR-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.25 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[1-[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]ethoxy]-5-(trifluoromethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]ethoxy]-5-(trifluoromethyl)pyridine?
The IUPAC name of 2-[1-[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]ethoxy]-5-(trifluoromethyl)pyridine (CID 66999110) is 2-[1-[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]ethoxy]-5-(trifluoromethyl)pyridine.
What is the SMILES notation for 2-[1-[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]ethoxy]-5-(trifluoromethyl)pyridine?
The canonical SMILES for 2-[1-[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]ethoxy]-5-(trifluoromethyl)pyridine is CC(Oc1ccc(C(F)(F)F)cn1)C1CNCC1c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-[1-[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]ethoxy]-5-(trifluoromethyl)pyridine?
The InChIKey is ZGOMNLGNLAFFBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17Cl2F3N2O/c1-10(26-17-5-3-12(7-25-17)18(21,22)23)13-8-24-9-14(13)11-2-4-15(19)16(20)6-11/h2-7,10,13-14,24H,8-9H2,1H3.
What are the key properties of 2-[1-[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]ethoxy]-5-(trifluoromethyl)pyridine?
2-[1-[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]ethoxy]-5-(trifluoromethyl)pyridine has a molecular weight of 405.25 g/mol, XLogP of 5.18, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]ethoxy]-5-(trifluoromethyl)pyridine is sourced from PubChem (CID 66999110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).