About porphyrin-2,3-diamine
porphyrin-2,3-diamine (PubChem CID 66999460) has the molecular formula C20H14N6
and a molecular weight of 338.37 g/mol. Its IUPAC name is porphyrin-2,3-diamine.
Molecular Properties
| Compound Name | porphyrin-2,3-diamine |
| PubChem CID | 66999460 |
| Molecular Formula | C20H14N6 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | porphyrin-2,3-diamine |
| SMILES | NC1=C(N)/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C=C3 |
| InChI | InChI=1S/C20H14N6/c21-19-17-9-15-5-3-13(24-15)7-11-1-2-12(23-11)8-14-4-6-16(25-14)10-18(26-17)20(19)22/h1-10H,21-22H2/b11-7-,12-8-,13-7-,14-8-,15-9-,16-10-,17-9-,18-10- |
| InChIKey | HUQRBZTUJZCRIB-ITJRXXQTSA-N |
| XLogP | 2.15 |
| TPSA | 101.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze porphyrin-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of porphyrin-2,3-diamine?
The IUPAC name of porphyrin-2,3-diamine (CID 66999460) is porphyrin-2,3-diamine.
What is the SMILES notation for porphyrin-2,3-diamine?
The canonical SMILES for porphyrin-2,3-diamine is NC1=C(N)/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C=C3.
What is the InChIKey of porphyrin-2,3-diamine?
The InChIKey is HUQRBZTUJZCRIB-ITJRXXQTSA-N. The full InChI is InChI=1S/C20H14N6/c21-19-17-9-15-5-3-13(24-15)7-11-1-2-12(23-11)8-14-4-6-16(25-14)10-18(26-17)20(19)22/h1-10H,21-22H2/b11-7-,12-8-,13-7-,14-8-,15-9-,16-10-,17-9-,18-10-.
What are the key properties of porphyrin-2,3-diamine?
porphyrin-2,3-diamine has a molecular weight of 338.37 g/mol, XLogP of 2.15, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for porphyrin-2,3-diamine is sourced from PubChem (CID 66999460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).