C23H30F2O4S — CID 66999872
7-[(1R,4R,5R)-5-[3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-2,2-difluoro-4-hydroxycyclopentyl]heptanoic acid (PubChem CID 66999872) has the molecular formula C23H30F2O4S and a molecular weight of 440.55 g/mol. Its IUPAC name is 7-[(1R,4R,5R)-5-[3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-2,2-difluoro-4-hydroxycyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,4R,5R)-5-[3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-2,2-difluoro-4-hydroxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 66999872 |
| Molecular Formula | C23H30F2O4S |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 7-[(1R,4R,5R)-5-[3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-2,2-difluoro-4-hydroxycyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@@H]1[C@@H](CCC(O)c2cc3ccccc3s2)[C@H](O)CC1(F)F |
| InChI | InChI=1S/C23H30F2O4S/c24-23(25)14-19(27)16(17(23)8-3-1-2-4-10-22(28)29)11-12-18(26)21-13-15-7-5-6-9-20(15)30-21/h5-7,9,13,16-19,26-27H,1-4,8,10-12,14H2,(H,28,29)/t16-,17-,18?,19-/m1/s1 |
| InChIKey | MRRJQPXMCORNAB-XGNHVKOBSA-N |
| XLogP | 5.77 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|