C32H45FO5 — CID 67000001
propan-2-yl (E)-7-[(1R,2R,3S,5S)-2-[(E,3S)-3-(2,3-dihydro-1H-inden-2-yl)-3-hydroxyprop-1-enyl]-3-fluoro-5-(oxan-2-yloxy)cyclopentyl]hept-5-enoate (PubChem CID 67000001) has the molecular formula C32H45FO5 and a molecular weight of 528.71 g/mol. Its IUPAC name is propan-2-yl (E)-7-[(1R,2R,3S,5S)-2-[(E,3S)-3-(2,3-dihydro-1H-inden-2-yl)-3-hydroxyprop-1-enyl]-3-fluoro-5-(oxan-2-yloxy)cyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (E)-7-[(1R,2R,3S,5S)-2-[(E,3S)-3-(2,3-dihydro-1H-inden-2-yl)-3-hydroxyprop-1-enyl]-3-fluoro-5-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 67000001 |
| Molecular Formula | C32H45FO5 |
| Molecular Weight | 528.71 g/mol |
| Exact Mass | 528.33 |
| IUPAC Name | propan-2-yl (E)-7-[(1R,2R,3S,5S)-2-[(E,3S)-3-(2,3-dihydro-1H-inden-2-yl)-3-hydroxyprop-1-enyl]-3-fluoro-5-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
| SMILES | CC(C)OC(=O)CCC/C=C/C[C@@H]1[C@@H](/C=C/[C@@H](O)C2Cc3ccccc3C2)[C@@H](F)C[C@@H]1OC1CCCCO1 |
| InChI | InChI=1S/C32H45FO5/c1-22(2)37-31(35)14-6-4-3-5-13-27-26(28(33)21-30(27)38-32-15-9-10-18-36-32)16-17-29(34)25-19-23-11-7-8-12-24(23)20-25/h3,5,7-8,11-12,16-17,22,25-30,32,34H,4,6,9-10,13-15,18-21H2,1-2H3/b5-3+,17-16+/t26-,27-,28+,29-,30+,32?/m1/s1 |
| InChIKey | SDGTXFKKLSIRSI-SHXRWRQHSA-N |
| XLogP | 6.27 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.71 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|