C14H19NO3S — CID 670001
ethyl 1-(2-thiophen-2-ylacetyl)piperidine-4-carboxylate (PubChem CID 670001) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is ethyl 1-(2-thiophen-2-ylacetyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(2-thiophen-2-ylacetyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 670001 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | ethyl 1-(2-thiophen-2-ylacetyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)Cc2cccs2)CC1 |
| InChI | InChI=1S/C14H19NO3S/c1-2-18-14(17)11-5-7-15(8-6-11)13(16)10-12-4-3-9-19-12/h3-4,9,11H,2,5-8,10H2,1H3 |
| InChIKey | YWUSFSDLDXNEKF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |