C23H26F2O4S — CID 67000394
(3aR,4R,5R,6aS)-4-[3-(1-benzothiophen-2-yl)-3,3-difluoroprop-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol (PubChem CID 67000394) has the molecular formula C23H26F2O4S and a molecular weight of 436.52 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[3-(1-benzothiophen-2-yl)-3,3-difluoroprop-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol.
| Compound Name | (3aR,4R,5R,6aS)-4-[3-(1-benzothiophen-2-yl)-3,3-difluoroprop-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 67000394 |
| Molecular Formula | C23H26F2O4S |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[3-(1-benzothiophen-2-yl)-3,3-difluoroprop-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
| SMILES | OC1C[C@@H]2[C@@H](C=CC(F)(F)c3cc4ccccc4s3)[C@H](OC3CCCCO3)C[C@@H]2O1 |
| InChI | InChI=1S/C23H26F2O4S/c24-23(25,20-11-14-5-1-2-6-19(14)30-20)9-8-15-16-12-21(26)28-18(16)13-17(15)29-22-7-3-4-10-27-22/h1-2,5-6,8-9,11,15-18,21-22,26H,3-4,7,10,12-13H2/t15-,16-,17-,18+,21?,22?/m1/s1 |
| InChIKey | ZZDYFLARJVOLCF-ULLINVQZSA-N |
| XLogP | 5.20 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|