C25H20O5S — CID 67000444
[(3aR,4R,5R,6aS)-4-[3-(1-benzothiophen-2-yl)-3-oxoprop-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate (PubChem CID 67000444) has the molecular formula C25H20O5S and a molecular weight of 432.50 g/mol. Its IUPAC name is [(3aR,4R,5R,6aS)-4-[3-(1-benzothiophen-2-yl)-3-oxoprop-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate.
| Compound Name | [(3aR,4R,5R,6aS)-4-[3-(1-benzothiophen-2-yl)-3-oxoprop-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
|---|---|
| PubChem CID | 67000444 |
| Molecular Formula | C25H20O5S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | [(3aR,4R,5R,6aS)-4-[3-(1-benzothiophen-2-yl)-3-oxoprop-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
| SMILES | O=C1C[C@@H]2[C@@H](C=CC(=O)c3cc4ccccc4s3)[C@H](OC(=O)c3ccccc3)C[C@@H]2O1 |
| InChI | InChI=1S/C25H20O5S/c26-19(23-12-16-8-4-5-9-22(16)31-23)11-10-17-18-13-24(27)29-21(18)14-20(17)30-25(28)15-6-2-1-3-7-15/h1-12,17-18,20-21H,13-14H2/t17-,18-,20-,21+/m1/s1 |
| InChIKey | UXODJZIERWRNPZ-UKAVVXHISA-N |
| XLogP | 4.82 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|