C21H35FO5 — CID 67000635
propan-2-yl 7-[(1R,2S,3S,5R)-3-fluoro-2-(hydroxymethyl)-5-(oxan-2-yloxy)cyclopentyl]hept-5-enoate (PubChem CID 67000635) has the molecular formula C21H35FO5 and a molecular weight of 386.50 g/mol. Its IUPAC name is propan-2-yl 7-[(1R,2S,3S,5R)-3-fluoro-2-(hydroxymethyl)-5-(oxan-2-yloxy)cyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl 7-[(1R,2S,3S,5R)-3-fluoro-2-(hydroxymethyl)-5-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 67000635 |
| Molecular Formula | C21H35FO5 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | propan-2-yl 7-[(1R,2S,3S,5R)-3-fluoro-2-(hydroxymethyl)-5-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
| SMILES | CC(C)OC(=O)CCCC=CC[C@@H]1[C@@H](CO)[C@@H](F)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C21H35FO5/c1-15(2)26-20(24)10-6-4-3-5-9-16-17(14-23)18(22)13-19(16)27-21-11-7-8-12-25-21/h3,5,15-19,21,23H,4,6-14H2,1-2H3/t16-,17-,18+,19-,21?/m1/s1 |
| InChIKey | MLRRBKGINFORAI-AVPDHNOJSA-N |
| XLogP | 3.93 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|