About 4-pentylsulfonylphenol
4-pentylsulfonylphenol (PubChem CID 67000666) has the molecular formula C11H16O3S
and a molecular weight of 228.31 g/mol. Its IUPAC name is 4-pentylsulfonylphenol.
Molecular Properties
| Compound Name | 4-pentylsulfonylphenol |
| PubChem CID | 67000666 |
| Molecular Formula | C11H16O3S |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 4-pentylsulfonylphenol |
| SMILES | CCCCCS(=O)(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C11H16O3S/c1-2-3-4-9-15(13,14)11-7-5-10(12)6-8-11/h5-8,12H,2-4,9H2,1H3 |
| InChIKey | AXHCQYWYHXCXMN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-pentylsulfonylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pentylsulfonylphenol?
The IUPAC name of 4-pentylsulfonylphenol (CID 67000666) is 4-pentylsulfonylphenol.
What is the SMILES notation for 4-pentylsulfonylphenol?
The canonical SMILES for 4-pentylsulfonylphenol is CCCCCS(=O)(=O)c1ccc(O)cc1.
What is the InChIKey of 4-pentylsulfonylphenol?
The InChIKey is AXHCQYWYHXCXMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3S/c1-2-3-4-9-15(13,14)11-7-5-10(12)6-8-11/h5-8,12H,2-4,9H2,1H3.
What are the key properties of 4-pentylsulfonylphenol?
4-pentylsulfonylphenol has a molecular weight of 228.31 g/mol, XLogP of 2.36, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pentylsulfonylphenol is sourced from PubChem (CID 67000666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).