C18H16F2O3S — CID 67000828
(3aR,4R,5R,6aS)-4-[3-(1-benzothiophen-2-yl)-3,3-difluoroprop-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 67000828) has the molecular formula C18H16F2O3S and a molecular weight of 350.39 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[3-(1-benzothiophen-2-yl)-3,3-difluoroprop-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-4-[3-(1-benzothiophen-2-yl)-3,3-difluoroprop-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 67000828 |
| Molecular Formula | C18H16F2O3S |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[3-(1-benzothiophen-2-yl)-3,3-difluoroprop-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | O=C1C[C@@H]2[C@@H](C=CC(F)(F)c3cc4ccccc4s3)[C@H](O)C[C@@H]2O1 |
| InChI | InChI=1S/C18H16F2O3S/c19-18(20,16-7-10-3-1-2-4-15(10)24-16)6-5-11-12-8-17(22)23-14(12)9-13(11)21/h1-7,11-14,21H,8-9H2/t11-,12-,13-,14+/m1/s1 |
| InChIKey | AOANZOUJCZSACF-SYQHCUMBSA-N |
| XLogP | 3.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|