C16H28Cl2N5O7P — CID 67001131
4-amino-1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;N,3-bis(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine (PubChem CID 67001131) has the molecular formula C16H28Cl2N5O7P and a molecular weight of 504.31 g/mol. Its IUPAC name is 4-amino-1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;N,3-bis(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine.
| Compound Name | 4-amino-1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;N,3-bis(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine |
|---|---|
| PubChem CID | 67001131 |
| Molecular Formula | C16H28Cl2N5O7P |
| Molecular Weight | 504.31 g/mol |
| Exact Mass | 503.11 |
| IUPAC Name | 4-amino-1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;N,3-bis(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine |
| SMILES | Nc1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@@H]2O)c(=O)n1.O=P1(NCCCl)OCCCN1CCCl |
| InChI | InChI=1S/C9H13N3O5.C7H15Cl2N2O2P/c10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8;8-2-4-10-14(12)11(6-3-9)5-1-7-13-14/h1-2,4,6-8,13-15H,3H2,(H2,10,11,16);1-7H2,(H,10,12)/t4-,6-,7+,8-;/m1./s1 |
| InChIKey | USSIHIRGKWSVIR-JBMRGDGGSA-N |
| XLogP | -0.68 |
| TPSA | 172.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.31 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|